C23H13BrN2O4 — CID 126383787
2-[(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile (PubChem CID 126383787) has the molecular formula C23H13BrN2O4 and a molecular weight of 461.27 g/mol. Its IUPAC name is 2-[(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile.
| Compound Name | 2-[(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile |
|---|---|
| PubChem CID | 126383787 |
| Molecular Formula | C23H13BrN2O4 |
| Molecular Weight | 461.27 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | 2-[(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile |
| SMILES | C#CCOc1ccc(Br)cc1C=Nc1oc(-c2ccco2)c(-c2ccco2)c1C#N |
| InChI | InChI=1S/C23H13BrN2O4/c1-2-9-27-18-8-7-16(24)12-15(18)14-26-23-17(13-25)21(19-5-3-10-28-19)22(30-23)20-6-4-11-29-20/h1,3-8,10-12,14H,9H2 |
| InChIKey | VLIUSDBQARYILN-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 84.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.27 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|