C27H16Cl2N2O4 — CID 126379848
2-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile (PubChem CID 126379848) has the molecular formula C27H16Cl2N2O4 and a molecular weight of 503.34 g/mol. Its IUPAC name is 2-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile.
| Compound Name | 2-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile |
|---|---|
| PubChem CID | 126379848 |
| Molecular Formula | C27H16Cl2N2O4 |
| Molecular Weight | 503.34 g/mol |
| Exact Mass | 502.05 |
| IUPAC Name | 2-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile |
| SMILES | N#Cc1c(N=Cc2cccc(OCc3ccc(Cl)cc3Cl)c2)oc(-c2ccco2)c1-c1ccco1 |
| InChI | InChI=1S/C27H16Cl2N2O4/c28-19-9-8-18(22(29)13-19)16-34-20-5-1-4-17(12-20)15-31-27-21(14-30)25(23-6-2-10-32-23)26(35-27)24-7-3-11-33-24/h1-13,15H,16H2 |
| InChIKey | HYDQCDZKESXQIH-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 84.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.34 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|