C23H20Cl2N4O2 — CID 92847211
2-[(2Z)-2-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile (PubChem CID 92847211) has the molecular formula C23H20Cl2N4O2 and a molecular weight of 455.35 g/mol. Its IUPAC name is 2-[(2Z)-2-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile.
| Compound Name | 2-[(2Z)-2-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 92847211 |
| Molecular Formula | C23H20Cl2N4O2 |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 2-[(2Z)-2-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile |
| SMILES | COCc1cc(C)nc(N/N=C\c2cccc(OCc3ccc(Cl)cc3Cl)c2)c1C#N |
| InChI | InChI=1S/C23H20Cl2N4O2/c1-15-8-18(13-30-2)21(11-26)23(28-15)29-27-12-16-4-3-5-20(9-16)31-14-17-6-7-19(24)10-22(17)25/h3-10,12H,13-14H2,1-2H3,(H,28,29)/b27-12- |
| InChIKey | PVDTUDOXRURROG-PPDIBHTLSA-N |
| XLogP | 5.74 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|