C24H22Cl2N4O3 — CID 6289357
2-[(2Z)-2-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile (PubChem CID 6289357) has the molecular formula C24H22Cl2N4O3 and a molecular weight of 485.37 g/mol. Its IUPAC name is 2-[(2Z)-2-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile.
| Compound Name | 2-[(2Z)-2-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 6289357 |
| Molecular Formula | C24H22Cl2N4O3 |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 2-[(2Z)-2-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile |
| SMILES | COCc1cc(C)nc(N/N=C\c2ccc(OCc3ccc(Cl)c(Cl)c3)c(OC)c2)c1C#N |
| InChI | InChI=1S/C24H22Cl2N4O3/c1-15-8-18(14-31-2)19(11-27)24(29-15)30-28-12-16-5-7-22(23(10-16)32-3)33-13-17-4-6-20(25)21(26)9-17/h4-10,12H,13-14H2,1-3H3,(H,29,30)/b28-12- |
| InChIKey | YEWBARUJACHUPJ-NVJOKUIPSA-N |
| XLogP | 5.75 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|