C20H17ClN4O2S — CID 126089667
2-[(2E)-2-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile (PubChem CID 126089667) has the molecular formula C20H17ClN4O2S and a molecular weight of 412.90 g/mol. Its IUPAC name is 2-[(2E)-2-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile.
| Compound Name | 2-[(2E)-2-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 126089667 |
| Molecular Formula | C20H17ClN4O2S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 2-[(2E)-2-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile |
| SMILES | COCc1cc(C)nc(N/N=C/c2ccc(Sc3ccc(Cl)cc3)o2)c1C#N |
| InChI | InChI=1S/C20H17ClN4O2S/c1-13-9-14(12-26-2)18(10-22)20(24-13)25-23-11-16-5-8-19(27-16)28-17-6-3-15(21)4-7-17/h3-9,11H,12H2,1-2H3,(H,24,25)/b23-11+ |
| InChIKey | VDSPNORFHOEICV-FOKLQQMPSA-N |
| XLogP | 5.25 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|