C16H15BrN4O3 — CID 136714309
2-[(2Z)-2-[(5-bromo-2,4-dihydroxyphenyl)methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile (PubChem CID 136714309) has the molecular formula C16H15BrN4O3 and a molecular weight of 391.23 g/mol. Its IUPAC name is 2-[(2Z)-2-[(5-bromo-2,4-dihydroxyphenyl)methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile.
| Compound Name | 2-[(2Z)-2-[(5-bromo-2,4-dihydroxyphenyl)methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 136714309 |
| Molecular Formula | C16H15BrN4O3 |
| Molecular Weight | 391.23 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 2-[(2Z)-2-[(5-bromo-2,4-dihydroxyphenyl)methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile |
| SMILES | COCc1cc(C)nc(N/N=C\c2cc(Br)c(O)cc2O)c1C#N |
| InChI | InChI=1S/C16H15BrN4O3/c1-9-3-11(8-24-2)12(6-18)16(20-9)21-19-7-10-4-13(17)15(23)5-14(10)22/h3-5,7,22-23H,8H2,1-2H3,(H,20,21)/b19-7- |
| InChIKey | OFQGUOXYQREMLJ-GXHLCREISA-N |
| XLogP | 3.03 |
| TPSA | 110.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.23 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|