C16H14N6O6 — CID 5037520
2-[2-[(2-hydroxy-3,5-dinitrophenyl)methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile (PubChem CID 5037520) has the molecular formula C16H14N6O6 and a molecular weight of 386.32 g/mol. Its IUPAC name is 2-[2-[(2-hydroxy-3,5-dinitrophenyl)methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile.
| Compound Name | 2-[2-[(2-hydroxy-3,5-dinitrophenyl)methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5037520 |
| Molecular Formula | C16H14N6O6 |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 2-[2-[(2-hydroxy-3,5-dinitrophenyl)methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile |
| SMILES | COCc1cc(C)nc(NN=Cc2cc([N+](=O)[O-])cc([N+](=O)[O-])c2O)c1C#N |
| InChI | InChI=1S/C16H14N6O6/c1-9-3-11(8-28-2)13(6-17)16(19-9)20-18-7-10-4-12(21(24)25)5-14(15(10)23)22(26)27/h3-5,7,23H,8H2,1-2H3,(H,19,20) |
| InChIKey | VPKDURIMTKHWNP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 176.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|