C20H22N6O4 — CID 7256175
4-(methoxymethyl)-6-methyl-2-[(2E)-2-[(2-morpholin-4-yl-5-nitrophenyl)methylidene]hydrazinyl]pyridine-3-carbonitrile (PubChem CID 7256175) has the molecular formula C20H22N6O4 and a molecular weight of 410.43 g/mol. Its IUPAC name is 4-(methoxymethyl)-6-methyl-2-[(2E)-2-[(2-morpholin-4-yl-5-nitrophenyl)methylidene]hydrazinyl]pyridine-3-carbonitrile.
| Compound Name | 4-(methoxymethyl)-6-methyl-2-[(2E)-2-[(2-morpholin-4-yl-5-nitrophenyl)methylidene]hydrazinyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 7256175 |
| Molecular Formula | C20H22N6O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 4-(methoxymethyl)-6-methyl-2-[(2E)-2-[(2-morpholin-4-yl-5-nitrophenyl)methylidene]hydrazinyl]pyridine-3-carbonitrile |
| SMILES | COCc1cc(C)nc(N/N=C/c2cc([N+](=O)[O-])ccc2N2CCOCC2)c1C#N |
| InChI | InChI=1S/C20H22N6O4/c1-14-9-16(13-29-2)18(11-21)20(23-14)24-22-12-15-10-17(26(27)28)3-4-19(15)25-5-7-30-8-6-25/h3-4,9-10,12H,5-8,13H2,1-2H3,(H,23,24)/b22-12+ |
| InChIKey | DNKOJNSXSYVXEO-WSDLNYQXSA-N |
| XLogP | 2.60 |
| TPSA | 125.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|