C16H15BrN4O — CID 3894925
2-[2-[(3-bromophenyl)methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile (PubChem CID 3894925) has the molecular formula C16H15BrN4O and a molecular weight of 359.23 g/mol. Its IUPAC name is 2-[2-[(3-bromophenyl)methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile.
| Compound Name | 2-[2-[(3-bromophenyl)methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3894925 |
| Molecular Formula | C16H15BrN4O |
| Molecular Weight | 359.23 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 2-[2-[(3-bromophenyl)methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile |
| SMILES | COCc1cc(C)nc(NN=Cc2cccc(Br)c2)c1C#N |
| InChI | InChI=1S/C16H15BrN4O/c1-11-6-13(10-22-2)15(8-18)16(20-11)21-19-9-12-4-3-5-14(17)7-12/h3-7,9H,10H2,1-2H3,(H,20,21) |
| InChIKey | PEWITYRUXVQZEA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 70.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.23 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|