C26H24BrN5O3 — CID 71820444
2-[2-[[3-bromo-4-[(2-cyanophenyl)methoxy]-5-ethoxyphenyl]methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile (PubChem CID 71820444) has the molecular formula C26H24BrN5O3 and a molecular weight of 534.41 g/mol. Its IUPAC name is 2-[2-[[3-bromo-4-[(2-cyanophenyl)methoxy]-5-ethoxyphenyl]methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile.
| Compound Name | 2-[2-[[3-bromo-4-[(2-cyanophenyl)methoxy]-5-ethoxyphenyl]methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 71820444 |
| Molecular Formula | C26H24BrN5O3 |
| Molecular Weight | 534.41 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | 2-[2-[[3-bromo-4-[(2-cyanophenyl)methoxy]-5-ethoxyphenyl]methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile |
| SMILES | CCOc1cc(C=NNc2nc(C)cc(COC)c2C#N)cc(Br)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C26H24BrN5O3/c1-4-34-24-11-18(10-23(27)25(24)35-16-20-8-6-5-7-19(20)12-28)14-30-32-26-22(13-29)21(15-33-3)9-17(2)31-26/h5-11,14H,4,15-16H2,1-3H3,(H,31,32) |
| InChIKey | ZOENJFJSOJLAMI-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.41 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|