C22H18BrN3O3S — CID 39378717
N-[(Z)-[3-bromo-4-[(2-cyanophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]thiophene-2-carboxamide (PubChem CID 39378717) has the molecular formula C22H18BrN3O3S and a molecular weight of 484.38 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-4-[(2-cyanophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[(Z)-[3-bromo-4-[(2-cyanophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 39378717 |
| Molecular Formula | C22H18BrN3O3S |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | N-[(Z)-[3-bromo-4-[(2-cyanophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]thiophene-2-carboxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2cccs2)cc(Br)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C22H18BrN3O3S/c1-2-28-19-11-15(13-25-26-22(27)20-8-5-9-30-20)10-18(23)21(19)29-14-17-7-4-3-6-16(17)12-24/h3-11,13H,2,14H2,1H3,(H,26,27)/b25-13- |
| InChIKey | QANZXAONSSAAEZ-MXAYSNPKSA-N |
| XLogP | 5.12 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|