C23H20I2N4O2 — CID 77115418
2-[2-[(3,5-diiodo-2-phenylmethoxyphenyl)methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile (PubChem CID 77115418) has the molecular formula C23H20I2N4O2 and a molecular weight of 638.25 g/mol. Its IUPAC name is 2-[2-[(3,5-diiodo-2-phenylmethoxyphenyl)methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile.
| Compound Name | 2-[2-[(3,5-diiodo-2-phenylmethoxyphenyl)methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 77115418 |
| Molecular Formula | C23H20I2N4O2 |
| Molecular Weight | 638.25 g/mol |
| Exact Mass | 637.97 |
| IUPAC Name | 2-[2-[(3,5-diiodo-2-phenylmethoxyphenyl)methylidene]hydrazinyl]-4-(methoxymethyl)-6-methylpyridine-3-carbonitrile |
| SMILES | COCc1cc(C)nc(NN=Cc2cc(I)cc(I)c2OCc2ccccc2)c1C#N |
| InChI | InChI=1S/C23H20I2N4O2/c1-15-8-18(14-30-2)20(11-26)23(28-15)29-27-12-17-9-19(24)10-21(25)22(17)31-13-16-6-4-3-5-7-16/h3-10,12H,13-14H2,1-2H3,(H,28,29) |
| InChIKey | YZXGVHVZUNIRDP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.25 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|