C22H20Cl2N2O — CID 110841009
N-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethylaniline (PubChem CID 110841009) has the molecular formula C22H20Cl2N2O and a molecular weight of 399.32 g/mol. Its IUPAC name is N-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethylaniline.
| Compound Name | N-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethylaniline |
|---|---|
| PubChem CID | 110841009 |
| Molecular Formula | C22H20Cl2N2O |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethylaniline |
| SMILES | Cc1ccc(NN=Cc2cccc(OCc3ccc(Cl)cc3Cl)c2)cc1C |
| InChI | InChI=1S/C22H20Cl2N2O/c1-15-6-9-20(10-16(15)2)26-25-13-17-4-3-5-21(11-17)27-14-18-7-8-19(23)12-22(18)24/h3-13,26H,14H2,1-2H3 |
| InChIKey | PEQUEYLASWYFDY-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|