C21H15Cl2F3N2O — CID 110841846
N-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-(trifluoromethyl)aniline (PubChem CID 110841846) has the molecular formula C21H15Cl2F3N2O and a molecular weight of 439.26 g/mol. Its IUPAC name is N-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-(trifluoromethyl)aniline.
| Compound Name | N-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 110841846 |
| Molecular Formula | C21H15Cl2F3N2O |
| Molecular Weight | 439.26 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | N-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1ccc(NN=Cc2cccc(OCc3ccc(Cl)cc3Cl)c2)cc1 |
| InChI | InChI=1S/C21H15Cl2F3N2O/c22-17-7-4-15(20(23)11-17)13-29-19-3-1-2-14(10-19)12-27-28-18-8-5-16(6-9-18)21(24,25)26/h1-12,28H,13H2 |
| InChIKey | FACBOSXSDRFSRN-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.26 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|