C23H19Cl2F3N2O2 — CID 110841540
N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-3-(trifluoromethyl)aniline (PubChem CID 110841540) has the molecular formula C23H19Cl2F3N2O2 and a molecular weight of 483.32 g/mol. Its IUPAC name is N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-3-(trifluoromethyl)aniline.
| Compound Name | N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 110841540 |
| Molecular Formula | C23H19Cl2F3N2O2 |
| Molecular Weight | 483.32 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-3-(trifluoromethyl)aniline |
| SMILES | CCOc1cc(C=NNc2cccc(C(F)(F)F)c2)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H19Cl2F3N2O2/c1-2-31-22-10-15(13-29-30-19-5-3-4-17(11-19)23(26,27)28)6-9-21(22)32-14-16-7-8-18(24)12-20(16)25/h3-13,30H,2,14H2,1H3 |
| InChIKey | JBSVWETUTJNOCM-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.32 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|