C28H17N3O4 — CID 126379631
2-[[4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile (PubChem CID 126379631) has the molecular formula C28H17N3O4 and a molecular weight of 459.46 g/mol. Its IUPAC name is 2-[[4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile.
| Compound Name | 2-[[4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile |
|---|---|
| PubChem CID | 126379631 |
| Molecular Formula | C28H17N3O4 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 2-[[4-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile |
| SMILES | N#Cc1ccccc1COc1ccc(C=Nc2oc(-c3ccco3)c(-c3ccco3)c2C#N)cc1 |
| InChI | InChI=1S/C28H17N3O4/c29-15-20-5-1-2-6-21(20)18-34-22-11-9-19(10-12-22)17-31-28-23(16-30)26(24-7-3-13-32-24)27(35-28)25-8-4-14-33-25/h1-14,17H,18H2 |
| InChIKey | DLYBOWCSNRHRKM-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 108.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|