C20H11N3O6 — CID 137094384
4,5-bis(furan-2-yl)-2-[(2-hydroxy-5-nitrophenyl)methylideneamino]furan-3-carbonitrile (PubChem CID 137094384) has the molecular formula C20H11N3O6 and a molecular weight of 389.32 g/mol. Its IUPAC name is 4,5-bis(furan-2-yl)-2-[(2-hydroxy-5-nitrophenyl)methylideneamino]furan-3-carbonitrile.
| Compound Name | 4,5-bis(furan-2-yl)-2-[(2-hydroxy-5-nitrophenyl)methylideneamino]furan-3-carbonitrile |
|---|---|
| PubChem CID | 137094384 |
| Molecular Formula | C20H11N3O6 |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 4,5-bis(furan-2-yl)-2-[(2-hydroxy-5-nitrophenyl)methylideneamino]furan-3-carbonitrile |
| SMILES | N#Cc1c(N=Cc2cc([N+](=O)[O-])ccc2O)oc(-c2ccco2)c1-c1ccco1 |
| InChI | InChI=1S/C20H11N3O6/c21-10-14-18(16-3-1-7-27-16)19(17-4-2-8-28-17)29-20(14)22-11-12-9-13(23(25)26)5-6-15(12)24/h1-9,11,24H |
| InChIKey | RKPVXCSGUZHDRT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 138.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|