C26H18BrN3O6 — CID 137059951
2-[(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile (PubChem CID 137059951) has the molecular formula C26H18BrN3O6 and a molecular weight of 548.35 g/mol. Its IUPAC name is 2-[(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile.
| Compound Name | 2-[(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile |
|---|---|
| PubChem CID | 137059951 |
| Molecular Formula | C26H18BrN3O6 |
| Molecular Weight | 548.35 g/mol |
| Exact Mass | 547.04 |
| IUPAC Name | 2-[(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile |
| SMILES | COc1ccc(-c2oc(N=Cc3cc([N+](=O)[O-])cc(Br)c3O)c(C#N)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H18BrN3O6/c1-34-19-7-3-15(4-8-19)23-21(13-28)26(36-25(23)16-5-9-20(35-2)10-6-16)29-14-17-11-18(30(32)33)12-22(27)24(17)31/h3-12,14,31H,1-2H3 |
| InChIKey | RHOHLIWAPFXKOK-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 131.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.35 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|