C26H18I2N2O4 — CID 137059908
2-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile (PubChem CID 137059908) has the molecular formula C26H18I2N2O4 and a molecular weight of 676.25 g/mol. Its IUPAC name is 2-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile.
| Compound Name | 2-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile |
|---|---|
| PubChem CID | 137059908 |
| Molecular Formula | C26H18I2N2O4 |
| Molecular Weight | 676.25 g/mol |
| Exact Mass | 675.94 |
| IUPAC Name | 2-[(2-hydroxy-3,5-diiodophenyl)methylideneamino]-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile |
| SMILES | COc1ccc(-c2oc(N=Cc3cc(I)cc(I)c3O)c(C#N)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H18I2N2O4/c1-32-19-7-3-15(4-8-19)23-21(13-29)26(30-14-17-11-18(27)12-22(28)24(17)31)34-25(23)16-5-9-20(33-2)10-6-16/h3-12,14,31H,1-2H3 |
| InChIKey | HZVTWSQCGVIKJJ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.25 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|