C26H19BrN2O5 — CID 3778168
2-[(5-bromo-2,4-dihydroxyphenyl)methylideneamino]-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile (PubChem CID 3778168) has the molecular formula C26H19BrN2O5 and a molecular weight of 519.35 g/mol. Its IUPAC name is 2-[(5-bromo-2,4-dihydroxyphenyl)methylideneamino]-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile.
| Compound Name | 2-[(5-bromo-2,4-dihydroxyphenyl)methylideneamino]-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile |
|---|---|
| PubChem CID | 3778168 |
| Molecular Formula | C26H19BrN2O5 |
| Molecular Weight | 519.35 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | 2-[(5-bromo-2,4-dihydroxyphenyl)methylideneamino]-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile |
| SMILES | COc1ccc(-c2oc(N=Cc3cc(Br)c(O)cc3O)c(C#N)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H19BrN2O5/c1-32-18-7-3-15(4-8-18)24-20(13-28)26(29-14-17-11-21(27)23(31)12-22(17)30)34-25(24)16-5-9-19(33-2)10-6-16/h3-12,14,30-31H,1-2H3 |
| InChIKey | SUAPBAXSENGBOZ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.35 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|