C28H23ClN2O5 — CID 137073142
2-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile (PubChem CID 137073142) has the molecular formula C28H23ClN2O5 and a molecular weight of 502.95 g/mol. Its IUPAC name is 2-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile.
| Compound Name | 2-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile |
|---|---|
| PubChem CID | 137073142 |
| Molecular Formula | C28H23ClN2O5 |
| Molecular Weight | 502.95 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | 2-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile |
| SMILES | CCOc1cc(C=Nc2oc(-c3ccc(OC)cc3)c(-c3ccc(OC)cc3)c2C#N)cc(Cl)c1O |
| InChI | InChI=1S/C28H23ClN2O5/c1-4-35-24-14-17(13-23(29)26(24)32)16-31-28-22(15-30)25(18-5-9-20(33-2)10-6-18)27(36-28)19-7-11-21(34-3)12-8-19/h5-14,16,32H,4H2,1-3H3 |
| InChIKey | FDGSYOQRSSERHO-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.95 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|