C28H23IN2O3 — CID 126369539
2-[(3-iodo-4,5-dimethoxyphenyl)methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile (PubChem CID 126369539) has the molecular formula C28H23IN2O3 and a molecular weight of 562.41 g/mol. Its IUPAC name is 2-[(3-iodo-4,5-dimethoxyphenyl)methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile.
| Compound Name | 2-[(3-iodo-4,5-dimethoxyphenyl)methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile |
|---|---|
| PubChem CID | 126369539 |
| Molecular Formula | C28H23IN2O3 |
| Molecular Weight | 562.41 g/mol |
| Exact Mass | 562.08 |
| IUPAC Name | 2-[(3-iodo-4,5-dimethoxyphenyl)methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile |
| SMILES | COc1cc(C=Nc2oc(-c3ccc(C)cc3)c(-c3ccc(C)cc3)c2C#N)cc(I)c1OC |
| InChI | InChI=1S/C28H23IN2O3/c1-17-5-9-20(10-6-17)25-22(15-30)28(34-26(25)21-11-7-18(2)8-12-21)31-16-19-13-23(29)27(33-4)24(14-19)32-3/h5-14,16H,1-4H3 |
| InChIKey | LRIXXTFGDXXDCJ-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 67.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.41 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|