C32H22Br2N2O3 — CID 126148077
2-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-4,5-diphenylfuran-3-carbonitrile (PubChem CID 126148077) has the molecular formula C32H22Br2N2O3 and a molecular weight of 642.35 g/mol. Its IUPAC name is 2-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-4,5-diphenylfuran-3-carbonitrile.
| Compound Name | 2-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-4,5-diphenylfuran-3-carbonitrile |
|---|---|
| PubChem CID | 126148077 |
| Molecular Formula | C32H22Br2N2O3 |
| Molecular Weight | 642.35 g/mol |
| Exact Mass | 640.00 |
| IUPAC Name | 2-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-4,5-diphenylfuran-3-carbonitrile |
| SMILES | COc1cc(C=Nc2oc(-c3ccccc3)c(-c3ccccc3)c2C#N)cc(Br)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C32H22Br2N2O3/c1-37-28-17-22(16-27(34)31(28)38-20-21-12-14-25(33)15-13-21)19-36-32-26(18-35)29(23-8-4-2-5-9-23)30(39-32)24-10-6-3-7-11-24/h2-17,19H,20H2,1H3 |
| InChIKey | BRQIXYNKOTYJOI-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 67.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.35 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|