C27H17BrN2O7 — CID 137068493
4,5-bis(1,3-benzodioxol-5-yl)-2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]furan-3-carbonitrile (PubChem CID 137068493) has the molecular formula C27H17BrN2O7 and a molecular weight of 561.34 g/mol. Its IUPAC name is 4,5-bis(1,3-benzodioxol-5-yl)-2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]furan-3-carbonitrile.
| Compound Name | 4,5-bis(1,3-benzodioxol-5-yl)-2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]furan-3-carbonitrile |
|---|---|
| PubChem CID | 137068493 |
| Molecular Formula | C27H17BrN2O7 |
| Molecular Weight | 561.34 g/mol |
| Exact Mass | 560.02 |
| IUPAC Name | 4,5-bis(1,3-benzodioxol-5-yl)-2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]furan-3-carbonitrile |
| SMILES | COc1cc(C=Nc2oc(-c3ccc4c(c3)OCO4)c(-c3ccc4c(c3)OCO4)c2C#N)cc(Br)c1O |
| InChI | InChI=1S/C27H17BrN2O7/c1-32-23-7-14(6-18(28)25(23)31)11-30-27-17(10-29)24(15-2-4-19-21(8-15)35-12-33-19)26(37-27)16-3-5-20-22(9-16)36-13-34-20/h2-9,11,31H,12-13H2,1H3 |
| InChIKey | OPZTVGCBQGATNG-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 115.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.34 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|