C34H27BrN2O3 — CID 126346783
2-[[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile (PubChem CID 126346783) has the molecular formula C34H27BrN2O3 and a molecular weight of 591.51 g/mol. Its IUPAC name is 2-[[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile.
| Compound Name | 2-[[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile |
|---|---|
| PubChem CID | 126346783 |
| Molecular Formula | C34H27BrN2O3 |
| Molecular Weight | 591.51 g/mol |
| Exact Mass | 590.12 |
| IUPAC Name | 2-[[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile |
| SMILES | COc1cc(C=Nc2oc(-c3ccc(C)cc3)c(-c3ccc(C)cc3)c2C#N)ccc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C34H27BrN2O3/c1-22-4-11-26(12-5-22)32-29(19-36)34(40-33(32)27-13-6-23(2)7-14-27)37-20-25-10-17-30(31(18-25)38-3)39-21-24-8-15-28(35)16-9-24/h4-18,20H,21H2,1-3H3 |
| InChIKey | AGBZMGBSSIDIPZ-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 67.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.51 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|