C33H25ClN2O2 — CID 126362742
2-[[2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile (PubChem CID 126362742) has the molecular formula C33H25ClN2O2 and a molecular weight of 517.03 g/mol. Its IUPAC name is 2-[[2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile.
| Compound Name | 2-[[2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile |
|---|---|
| PubChem CID | 126362742 |
| Molecular Formula | C33H25ClN2O2 |
| Molecular Weight | 517.03 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 2-[[2-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile |
| SMILES | Cc1ccc(-c2oc(N=Cc3ccccc3OCc3ccc(Cl)cc3)c(C#N)c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C33H25ClN2O2/c1-22-7-13-25(14-8-22)31-29(19-35)33(38-32(31)26-15-9-23(2)10-16-26)36-20-27-5-3-4-6-30(27)37-21-24-11-17-28(34)18-12-24/h3-18,20H,21H2,1-2H3 |
| InChIKey | QTOMJQMJBLCKFW-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 58.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.03 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|