C39H32N2O3 — CID 126347735
2-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile (PubChem CID 126347735) has the molecular formula C39H32N2O3 and a molecular weight of 576.70 g/mol. Its IUPAC name is 2-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile.
| Compound Name | 2-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile |
|---|---|
| PubChem CID | 126347735 |
| Molecular Formula | C39H32N2O3 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | 2-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile |
| SMILES | CCOc1cc(C=Nc2oc(-c3ccc(C)cc3)c(-c3ccc(C)cc3)c2C#N)ccc1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C39H32N2O3/c1-4-42-36-22-28(16-21-35(36)43-25-32-10-7-9-29-8-5-6-11-33(29)32)24-41-39-34(23-40)37(30-17-12-26(2)13-18-30)38(44-39)31-19-14-27(3)15-20-31/h5-22,24H,4,25H2,1-3H3 |
| InChIKey | FIFHFXYROZNNED-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 67.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|