C33H24Br2N2O3 — CID 126149375
2-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-4,5-diphenylfuran-3-carbonitrile (PubChem CID 126149375) has the molecular formula C33H24Br2N2O3 and a molecular weight of 656.37 g/mol. Its IUPAC name is 2-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-4,5-diphenylfuran-3-carbonitrile.
| Compound Name | 2-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-4,5-diphenylfuran-3-carbonitrile |
|---|---|
| PubChem CID | 126149375 |
| Molecular Formula | C33H24Br2N2O3 |
| Molecular Weight | 656.37 g/mol |
| Exact Mass | 654.02 |
| IUPAC Name | 2-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-4,5-diphenylfuran-3-carbonitrile |
| SMILES | CCOc1cc(C=Nc2oc(-c3ccccc3)c(-c3ccccc3)c2C#N)cc(Br)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C33H24Br2N2O3/c1-2-38-29-18-23(17-28(35)32(29)39-21-22-13-15-26(34)16-14-22)20-37-33-27(19-36)30(24-9-5-3-6-10-24)31(40-33)25-11-7-4-8-12-25/h3-18,20H,2,21H2,1H3 |
| InChIKey | MVQPXIVOMLJFFF-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 67.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.37 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|