C20H15BrN2O2 — CID 91322901
ethyl N-[5-(4-bromophenyl)-3-cyano-4-phenylfuran-2-yl]methanimidate (PubChem CID 91322901) has the molecular formula C20H15BrN2O2 and a molecular weight of 395.26 g/mol. Its IUPAC name is ethyl N-[5-(4-bromophenyl)-3-cyano-4-phenylfuran-2-yl]methanimidate.
| Compound Name | ethyl N-[5-(4-bromophenyl)-3-cyano-4-phenylfuran-2-yl]methanimidate |
|---|---|
| PubChem CID | 91322901 |
| Molecular Formula | C20H15BrN2O2 |
| Molecular Weight | 395.26 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | ethyl N-[5-(4-bromophenyl)-3-cyano-4-phenylfuran-2-yl]methanimidate |
| SMILES | CCOC=Nc1oc(-c2ccc(Br)cc2)c(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C20H15BrN2O2/c1-2-24-13-23-20-17(12-22)18(14-6-4-3-5-7-14)19(25-20)15-8-10-16(21)11-9-15/h3-11,13H,2H2,1H3 |
| InChIKey | HRPWODHJMMMAGP-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 58.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.26 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|