C28H22N2O3 — CID 21370735
4,5-bis(4-methoxyphenyl)-2-[(E)-[(E)-3-phenylprop-2-enylidene]amino]furan-3-carbonitrile (PubChem CID 21370735) has the molecular formula C28H22N2O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is 4,5-bis(4-methoxyphenyl)-2-[(E)-[(E)-3-phenylprop-2-enylidene]amino]furan-3-carbonitrile.
| Compound Name | 4,5-bis(4-methoxyphenyl)-2-[(E)-[(E)-3-phenylprop-2-enylidene]amino]furan-3-carbonitrile |
|---|---|
| PubChem CID | 21370735 |
| Molecular Formula | C28H22N2O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 4,5-bis(4-methoxyphenyl)-2-[(E)-[(E)-3-phenylprop-2-enylidene]amino]furan-3-carbonitrile |
| SMILES | COc1ccc(-c2oc(/N=C/C=C/c3ccccc3)c(C#N)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H22N2O3/c1-31-23-14-10-21(11-15-23)26-25(19-29)28(30-18-6-9-20-7-4-3-5-8-20)33-27(26)22-12-16-24(32-2)17-13-22/h3-18H,1-2H3/b9-6+,30-18+ |
| InChIKey | FWZGPHYKWFNXSV-GXCKHALYSA-N |
| XLogP | 6.92 |
| TPSA | 67.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|