C27H22N2O5 — CID 137059625
2-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile (PubChem CID 137059625) has the molecular formula C27H22N2O5 and a molecular weight of 454.48 g/mol. Its IUPAC name is 2-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile.
| Compound Name | 2-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile |
|---|---|
| PubChem CID | 137059625 |
| Molecular Formula | C27H22N2O5 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 2-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile |
| SMILES | COc1ccc(-c2oc(N=Cc3ccc(O)c(OC)c3)c(C#N)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H22N2O5/c1-31-20-9-5-18(6-10-20)25-22(15-28)27(29-16-17-4-13-23(30)24(14-17)33-3)34-26(25)19-7-11-21(32-2)12-8-19/h4-14,16,30H,1-3H3 |
| InChIKey | MMABPMHZVBHSTN-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|