C29H26N2O6 — CID 21240132
4,5-bis(4-methoxyphenyl)-2-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]furan-3-carbonitrile (PubChem CID 21240132) has the molecular formula C29H26N2O6 and a molecular weight of 498.54 g/mol. Its IUPAC name is 4,5-bis(4-methoxyphenyl)-2-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]furan-3-carbonitrile.
| Compound Name | 4,5-bis(4-methoxyphenyl)-2-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]furan-3-carbonitrile |
|---|---|
| PubChem CID | 21240132 |
| Molecular Formula | C29H26N2O6 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 4,5-bis(4-methoxyphenyl)-2-[(E)-(2,4,5-trimethoxyphenyl)methylideneamino]furan-3-carbonitrile |
| SMILES | COc1ccc(-c2oc(/N=C/c3cc(OC)c(OC)cc3OC)c(C#N)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H26N2O6/c1-32-21-10-6-18(7-11-21)27-23(16-30)29(37-28(27)19-8-12-22(33-2)13-9-19)31-17-20-14-25(35-4)26(36-5)15-24(20)34-3/h6-15,17H,1-5H3/b31-17+ |
| InChIKey | DQGKRAWANBPZBW-KBVAKVRCSA-N |
| XLogP | 6.28 |
| TPSA | 95.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|