C39H27N3O2 — CID 10008182
2-[(E)-(6-methoxy-2,3-diphenyl-1H-indol-5-yl)methylideneamino]-4,5-diphenylfuran-3-carbonitrile (PubChem CID 10008182) has the molecular formula C39H27N3O2 and a molecular weight of 569.66 g/mol. Its IUPAC name is 2-[(E)-(6-methoxy-2,3-diphenyl-1H-indol-5-yl)methylideneamino]-4,5-diphenylfuran-3-carbonitrile.
| Compound Name | 2-[(E)-(6-methoxy-2,3-diphenyl-1H-indol-5-yl)methylideneamino]-4,5-diphenylfuran-3-carbonitrile |
|---|---|
| PubChem CID | 10008182 |
| Molecular Formula | C39H27N3O2 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | 2-[(E)-(6-methoxy-2,3-diphenyl-1H-indol-5-yl)methylideneamino]-4,5-diphenylfuran-3-carbonitrile |
| SMILES | COc1cc2[nH]c(-c3ccccc3)c(-c3ccccc3)c2cc1/C=N/c1oc(-c2ccccc2)c(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C39H27N3O2/c1-43-34-23-33-31(35(26-14-6-2-7-15-26)37(42-33)28-18-10-4-11-19-28)22-30(34)25-41-39-32(24-40)36(27-16-8-3-9-17-27)38(44-39)29-20-12-5-13-21-29/h2-23,25,42H,1H3/b41-25+ |
| InChIKey | FYSUXHJLJMMULU-UACWCTJZSA-N |
| XLogP | 10.06 |
| TPSA | 74.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|