C25H17BrN2O3 — CID 137068725
2-[(3-bromo-2-hydroxy-5-methoxyphenyl)methylideneamino]-4,5-diphenylfuran-3-carbonitrile (PubChem CID 137068725) has the molecular formula C25H17BrN2O3 and a molecular weight of 473.33 g/mol. Its IUPAC name is 2-[(3-bromo-2-hydroxy-5-methoxyphenyl)methylideneamino]-4,5-diphenylfuran-3-carbonitrile.
| Compound Name | 2-[(3-bromo-2-hydroxy-5-methoxyphenyl)methylideneamino]-4,5-diphenylfuran-3-carbonitrile |
|---|---|
| PubChem CID | 137068725 |
| Molecular Formula | C25H17BrN2O3 |
| Molecular Weight | 473.33 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | 2-[(3-bromo-2-hydroxy-5-methoxyphenyl)methylideneamino]-4,5-diphenylfuran-3-carbonitrile |
| SMILES | COc1cc(Br)c(O)c(C=Nc2oc(-c3ccccc3)c(-c3ccccc3)c2C#N)c1 |
| InChI | InChI=1S/C25H17BrN2O3/c1-30-19-12-18(23(29)21(26)13-19)15-28-25-20(14-27)22(16-8-4-2-5-9-16)24(31-25)17-10-6-3-7-11-17/h2-13,15,29H,1H3 |
| InChIKey | FFBNJFYMTMHCDE-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 78.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.33 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|