C31H23BrN2O4 — CID 126150184
2-[[5-(3-bromo-4-methylphenyl)furan-2-yl]methylideneamino]-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile (PubChem CID 126150184) has the molecular formula C31H23BrN2O4 and a molecular weight of 567.44 g/mol. Its IUPAC name is 2-[[5-(3-bromo-4-methylphenyl)furan-2-yl]methylideneamino]-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile.
| Compound Name | 2-[[5-(3-bromo-4-methylphenyl)furan-2-yl]methylideneamino]-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile |
|---|---|
| PubChem CID | 126150184 |
| Molecular Formula | C31H23BrN2O4 |
| Molecular Weight | 567.44 g/mol |
| Exact Mass | 566.08 |
| IUPAC Name | 2-[[5-(3-bromo-4-methylphenyl)furan-2-yl]methylideneamino]-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile |
| SMILES | COc1ccc(-c2oc(N=Cc3ccc(-c4ccc(C)c(Br)c4)o3)c(C#N)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H23BrN2O4/c1-19-4-5-22(16-27(19)32)28-15-14-25(37-28)18-34-31-26(17-33)29(20-6-10-23(35-2)11-7-20)30(38-31)21-8-12-24(36-3)13-9-21/h4-16,18H,1-3H3 |
| InChIKey | WPULOEOXQRGBHF-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 80.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.44 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|