C24H14Br2N2O2 — CID 135800066
2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-4,5-diphenylfuran-3-carbonitrile (PubChem CID 135800066) has the molecular formula C24H14Br2N2O2 and a molecular weight of 522.20 g/mol. Its IUPAC name is 2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-4,5-diphenylfuran-3-carbonitrile.
| Compound Name | 2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-4,5-diphenylfuran-3-carbonitrile |
|---|---|
| PubChem CID | 135800066 |
| Molecular Formula | C24H14Br2N2O2 |
| Molecular Weight | 522.20 g/mol |
| Exact Mass | 519.94 |
| IUPAC Name | 2-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]-4,5-diphenylfuran-3-carbonitrile |
| SMILES | N#Cc1c(/N=C/c2cc(Br)cc(Br)c2O)oc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C24H14Br2N2O2/c25-18-11-17(22(29)20(26)12-18)14-28-24-19(13-27)21(15-7-3-1-4-8-15)23(30-24)16-9-5-2-6-10-16/h1-12,14,29H/b28-14+ |
| InChIKey | VWCCGOUAFPICFI-CCVNUDIWSA-N |
| XLogP | 7.47 |
| TPSA | 69.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.20 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|