C25H15N3O5 — CID 3595524
2-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4,5-diphenylfuran-3-carbonitrile (PubChem CID 3595524) has the molecular formula C25H15N3O5 and a molecular weight of 437.41 g/mol. Its IUPAC name is 2-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4,5-diphenylfuran-3-carbonitrile.
| Compound Name | 2-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4,5-diphenylfuran-3-carbonitrile |
|---|---|
| PubChem CID | 3595524 |
| Molecular Formula | C25H15N3O5 |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 2-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-4,5-diphenylfuran-3-carbonitrile |
| SMILES | N#Cc1c(N=Cc2cc3c(cc2[N+](=O)[O-])OCO3)oc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C25H15N3O5/c26-13-19-23(16-7-3-1-4-8-16)24(17-9-5-2-6-10-17)33-25(19)27-14-18-11-21-22(32-15-31-21)12-20(18)28(29)30/h1-12,14H,15H2 |
| InChIKey | ALXRAJNZXSEGFK-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 110.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|