C14H9FN2O4 — CID 825715
N-(2-fluorophenyl)-1-(6-nitro-1,3-benzodioxol-5-yl)methanimine (PubChem CID 825715) has the molecular formula C14H9FN2O4 and a molecular weight of 288.23 g/mol. Its IUPAC name is N-(2-fluorophenyl)-1-(6-nitro-1,3-benzodioxol-5-yl)methanimine.
| Compound Name | N-(2-fluorophenyl)-1-(6-nitro-1,3-benzodioxol-5-yl)methanimine |
|---|---|
| PubChem CID | 825715 |
| Molecular Formula | C14H9FN2O4 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | N-(2-fluorophenyl)-1-(6-nitro-1,3-benzodioxol-5-yl)methanimine |
| SMILES | O=[N+]([O-])c1cc2c(cc1/C=N/c1ccccc1F)OCO2 |
| InChI | InChI=1S/C14H9FN2O4/c15-10-3-1-2-4-11(10)16-7-9-5-13-14(21-8-20-13)6-12(9)17(18)19/h1-7H,8H2/b16-7+ |
| InChIKey | XVGXOBULGOOYOR-FRKPEAEDSA-N |
| XLogP | 3.21 |
| TPSA | 73.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|