C21H17N3O6S — CID 1085164
N-[2-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]phenyl]-1-phenylmethanesulfonamide (PubChem CID 1085164) has the molecular formula C21H17N3O6S and a molecular weight of 439.45 g/mol. Its IUPAC name is N-[2-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]phenyl]-1-phenylmethanesulfonamide.
| Compound Name | N-[2-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]phenyl]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 1085164 |
| Molecular Formula | C21H17N3O6S |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | N-[2-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]phenyl]-1-phenylmethanesulfonamide |
| SMILES | O=[N+]([O-])c1cc2c(cc1/C=N/c1ccccc1NS(=O)(=O)Cc1ccccc1)OCO2 |
| InChI | InChI=1S/C21H17N3O6S/c25-24(26)19-11-21-20(29-14-30-21)10-16(19)12-22-17-8-4-5-9-18(17)23-31(27,28)13-15-6-2-1-3-7-15/h1-12,23H,13-14H2/b22-12+ |
| InChIKey | CZLGOBFEMKXCKU-WSDLNYQXSA-N |
| XLogP | 4.02 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|