C31H21N3O3S — CID 126122951
2-[[2-(4-methylphenyl)sulfanyl-5-nitrophenyl]methylideneamino]-4,5-diphenylfuran-3-carbonitrile (PubChem CID 126122951) has the molecular formula C31H21N3O3S and a molecular weight of 515.59 g/mol. Its IUPAC name is 2-[[2-(4-methylphenyl)sulfanyl-5-nitrophenyl]methylideneamino]-4,5-diphenylfuran-3-carbonitrile.
| Compound Name | 2-[[2-(4-methylphenyl)sulfanyl-5-nitrophenyl]methylideneamino]-4,5-diphenylfuran-3-carbonitrile |
|---|---|
| PubChem CID | 126122951 |
| Molecular Formula | C31H21N3O3S |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 2-[[2-(4-methylphenyl)sulfanyl-5-nitrophenyl]methylideneamino]-4,5-diphenylfuran-3-carbonitrile |
| SMILES | Cc1ccc(Sc2ccc([N+](=O)[O-])cc2C=Nc2oc(-c3ccccc3)c(-c3ccccc3)c2C#N)cc1 |
| InChI | InChI=1S/C31H21N3O3S/c1-21-12-15-26(16-13-21)38-28-17-14-25(34(35)36)18-24(28)20-33-31-27(19-32)29(22-8-4-2-5-9-22)30(37-31)23-10-6-3-7-11-23/h2-18,20H,1H3 |
| InChIKey | JTQFOSRBVBJVKL-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 92.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|