C28H21N3O2 — CID 126357508
2-[[2-(cyanomethoxy)phenyl]methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile (PubChem CID 126357508) has the molecular formula C28H21N3O2 and a molecular weight of 431.50 g/mol. Its IUPAC name is 2-[[2-(cyanomethoxy)phenyl]methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile.
| Compound Name | 2-[[2-(cyanomethoxy)phenyl]methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile |
|---|---|
| PubChem CID | 126357508 |
| Molecular Formula | C28H21N3O2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 2-[[2-(cyanomethoxy)phenyl]methylideneamino]-4,5-bis(4-methylphenyl)furan-3-carbonitrile |
| SMILES | Cc1ccc(-c2oc(N=Cc3ccccc3OCC#N)c(C#N)c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H21N3O2/c1-19-7-11-21(12-8-19)26-24(17-30)28(33-27(26)22-13-9-20(2)10-14-22)31-18-23-5-3-4-6-25(23)32-16-15-29/h3-14,18H,16H2,1-2H3 |
| InChIKey | ZIXWXLNJMYOALE-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 82.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|