C36H29N3O3 — CID 5007245
4,5-bis(4-methoxyphenyl)-2-[[1-[(4-methylphenyl)methyl]indol-3-yl]methylideneamino]furan-3-carbonitrile (PubChem CID 5007245) has the molecular formula C36H29N3O3 and a molecular weight of 551.65 g/mol. Its IUPAC name is 4,5-bis(4-methoxyphenyl)-2-[[1-[(4-methylphenyl)methyl]indol-3-yl]methylideneamino]furan-3-carbonitrile.
| Compound Name | 4,5-bis(4-methoxyphenyl)-2-[[1-[(4-methylphenyl)methyl]indol-3-yl]methylideneamino]furan-3-carbonitrile |
|---|---|
| PubChem CID | 5007245 |
| Molecular Formula | C36H29N3O3 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | 4,5-bis(4-methoxyphenyl)-2-[[1-[(4-methylphenyl)methyl]indol-3-yl]methylideneamino]furan-3-carbonitrile |
| SMILES | COc1ccc(-c2oc(N=Cc3cn(Cc4ccc(C)cc4)c4ccccc34)c(C#N)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C36H29N3O3/c1-24-8-10-25(11-9-24)22-39-23-28(31-6-4-5-7-33(31)39)21-38-36-32(20-37)34(26-12-16-29(40-2)17-13-26)35(42-36)27-14-18-30(41-3)19-15-27/h4-19,21,23H,22H2,1-3H3 |
| InChIKey | IXCQOXSVSKPAAV-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|