C29H19N3O3 — CID 126389331
2-[(1-benzylindol-3-yl)methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile (PubChem CID 126389331) has the molecular formula C29H19N3O3 and a molecular weight of 457.49 g/mol. Its IUPAC name is 2-[(1-benzylindol-3-yl)methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile.
| Compound Name | 2-[(1-benzylindol-3-yl)methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile |
|---|---|
| PubChem CID | 126389331 |
| Molecular Formula | C29H19N3O3 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 2-[(1-benzylindol-3-yl)methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile |
| SMILES | N#Cc1c(N=Cc2cn(Cc3ccccc3)c3ccccc23)oc(-c2ccco2)c1-c1ccco1 |
| InChI | InChI=1S/C29H19N3O3/c30-16-23-27(25-12-6-14-33-25)28(26-13-7-15-34-26)35-29(23)31-17-21-19-32(18-20-8-2-1-3-9-20)24-11-5-4-10-22(21)24/h1-15,17,19H,18H2 |
| InChIKey | GEOQEJCXJVCILJ-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 80.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|