C25H14N2O6 — CID 126385016
2-[5-[[3-cyano-4,5-bis(furan-2-yl)furan-2-yl]iminomethyl]furan-2-yl]benzoic acid (PubChem CID 126385016) has the molecular formula C25H14N2O6 and a molecular weight of 438.40 g/mol. Its IUPAC name is 2-[5-[[3-cyano-4,5-bis(furan-2-yl)furan-2-yl]iminomethyl]furan-2-yl]benzoic acid.
| Compound Name | 2-[5-[[3-cyano-4,5-bis(furan-2-yl)furan-2-yl]iminomethyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 126385016 |
| Molecular Formula | C25H14N2O6 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 2-[5-[[3-cyano-4,5-bis(furan-2-yl)furan-2-yl]iminomethyl]furan-2-yl]benzoic acid |
| SMILES | N#Cc1c(N=Cc2ccc(-c3ccccc3C(=O)O)o2)oc(-c2ccco2)c1-c1ccco1 |
| InChI | InChI=1S/C25H14N2O6/c26-13-18-22(20-7-3-11-30-20)23(21-8-4-12-31-21)33-24(18)27-14-15-9-10-19(32-15)16-5-1-2-6-17(16)25(28)29/h1-12,14H,(H,28,29) |
| InChIKey | DLJZRIUVGZRYKL-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 126.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|