C24H18N2O6 — CID 126384129
ethyl 2-[4-[[3-cyano-4,5-bis(furan-2-yl)furan-2-yl]iminomethyl]phenoxy]acetate (PubChem CID 126384129) has the molecular formula C24H18N2O6 and a molecular weight of 430.42 g/mol. Its IUPAC name is ethyl 2-[4-[[3-cyano-4,5-bis(furan-2-yl)furan-2-yl]iminomethyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[[3-cyano-4,5-bis(furan-2-yl)furan-2-yl]iminomethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126384129 |
| Molecular Formula | C24H18N2O6 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | ethyl 2-[4-[[3-cyano-4,5-bis(furan-2-yl)furan-2-yl]iminomethyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C=Nc2oc(-c3ccco3)c(-c3ccco3)c2C#N)cc1 |
| InChI | InChI=1S/C24H18N2O6/c1-2-28-21(27)15-31-17-9-7-16(8-10-17)14-26-24-18(13-25)22(19-5-3-11-29-19)23(32-24)20-6-4-12-30-20/h3-12,14H,2,15H2,1H3 |
| InChIKey | XPGPAFNLVJZCKW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 111.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|