C21H13BrN2O4 — CID 2358220
2-[(5-bromo-2-methoxyphenyl)methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile (PubChem CID 2358220) has the molecular formula C21H13BrN2O4 and a molecular weight of 437.25 g/mol. Its IUPAC name is 2-[(5-bromo-2-methoxyphenyl)methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile.
| Compound Name | 2-[(5-bromo-2-methoxyphenyl)methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile |
|---|---|
| PubChem CID | 2358220 |
| Molecular Formula | C21H13BrN2O4 |
| Molecular Weight | 437.25 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | 2-[(5-bromo-2-methoxyphenyl)methylideneamino]-4,5-bis(furan-2-yl)furan-3-carbonitrile |
| SMILES | COc1ccc(Br)cc1C=Nc1oc(-c2ccco2)c(-c2ccco2)c1C#N |
| InChI | InChI=1S/C21H13BrN2O4/c1-25-16-7-6-14(22)10-13(16)12-24-21-15(11-23)19(17-4-2-8-26-17)20(28-21)18-5-3-9-27-18/h2-10,12H,1H3 |
| InChIKey | YSMXHJXSKXLJDT-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 84.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.25 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|