C27H19N3O7 — CID 1102195
4,5-bis(4-methoxyphenyl)-2-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]furan-3-carbonitrile (PubChem CID 1102195) has the molecular formula C27H19N3O7 and a molecular weight of 497.46 g/mol. Its IUPAC name is 4,5-bis(4-methoxyphenyl)-2-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]furan-3-carbonitrile.
| Compound Name | 4,5-bis(4-methoxyphenyl)-2-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]furan-3-carbonitrile |
|---|---|
| PubChem CID | 1102195 |
| Molecular Formula | C27H19N3O7 |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 4,5-bis(4-methoxyphenyl)-2-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]furan-3-carbonitrile |
| SMILES | COc1ccc(-c2oc(N=Cc3cc4c(cc3[N+](=O)[O-])OCO4)c(C#N)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H19N3O7/c1-33-19-7-3-16(4-8-19)25-21(13-28)27(37-26(25)17-5-9-20(34-2)10-6-17)29-14-18-11-23-24(36-15-35-23)12-22(18)30(31)32/h3-12,14H,15H2,1-2H3 |
| InChIKey | LAOXQTUPKKGRSS-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 129.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|