C24H16ClN3O — CID 172676960
N-(4-chlorophenyl)-N'-(3-cyano-4,5-diphenylfuran-2-yl)methanimidamide (PubChem CID 172676960) has the molecular formula C24H16ClN3O and a molecular weight of 397.87 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N'-(3-cyano-4,5-diphenylfuran-2-yl)methanimidamide.
| Compound Name | N-(4-chlorophenyl)-N'-(3-cyano-4,5-diphenylfuran-2-yl)methanimidamide |
|---|---|
| PubChem CID | 172676960 |
| Molecular Formula | C24H16ClN3O |
| Molecular Weight | 397.87 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | N-(4-chlorophenyl)-N'-(3-cyano-4,5-diphenylfuran-2-yl)methanimidamide |
| SMILES | N#Cc1c(/N=C/Nc2ccc(Cl)cc2)oc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C24H16ClN3O/c25-19-11-13-20(14-12-19)27-16-28-24-21(15-26)22(17-7-3-1-4-8-17)23(29-24)18-9-5-2-6-10-18/h1-14,16H,(H,27,28) |
| InChIKey | IHYBNWZDUVAZNY-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 61.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.87 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|