C28H23BrClNO3 — CID 126221350
1-[4-[(4-bromophenyl)methoxy]-3-chloro-5-ethoxyphenyl]-N-(4-phenoxyphenyl)methanimine (PubChem CID 126221350) has the molecular formula C28H23BrClNO3 and a molecular weight of 536.85 g/mol. Its IUPAC name is 1-[4-[(4-bromophenyl)methoxy]-3-chloro-5-ethoxyphenyl]-N-(4-phenoxyphenyl)methanimine.
| Compound Name | 1-[4-[(4-bromophenyl)methoxy]-3-chloro-5-ethoxyphenyl]-N-(4-phenoxyphenyl)methanimine |
|---|---|
| PubChem CID | 126221350 |
| Molecular Formula | C28H23BrClNO3 |
| Molecular Weight | 536.85 g/mol |
| Exact Mass | 535.05 |
| IUPAC Name | 1-[4-[(4-bromophenyl)methoxy]-3-chloro-5-ethoxyphenyl]-N-(4-phenoxyphenyl)methanimine |
| SMILES | CCOc1cc(/C=N/c2ccc(Oc3ccccc3)cc2)cc(Cl)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C28H23BrClNO3/c1-2-32-27-17-21(16-26(30)28(27)33-19-20-8-10-22(29)11-9-20)18-31-23-12-14-25(15-13-23)34-24-6-4-3-5-7-24/h3-18H,2,19H2,1H3/b31-18+ |
| InChIKey | XLXJQZHIIOSNMG-FDAWAROLSA-N |
| XLogP | 8.62 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.85 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|