C27H21ClFNO3 — CID 126223016
1-[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]-N-(4-phenoxyphenyl)methanimine (PubChem CID 126223016) has the molecular formula C27H21ClFNO3 and a molecular weight of 461.92 g/mol. Its IUPAC name is 1-[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]-N-(4-phenoxyphenyl)methanimine.
| Compound Name | 1-[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]-N-(4-phenoxyphenyl)methanimine |
|---|---|
| PubChem CID | 126223016 |
| Molecular Formula | C27H21ClFNO3 |
| Molecular Weight | 461.92 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 1-[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]-N-(4-phenoxyphenyl)methanimine |
| SMILES | COc1cc(/C=N/c2ccc(Oc3ccccc3)cc2)cc(Cl)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C27H21ClFNO3/c1-31-26-16-20(15-25(28)27(26)32-18-19-7-9-21(29)10-8-19)17-30-22-11-13-24(14-12-22)33-23-5-3-2-4-6-23/h2-17H,18H2,1H3/b30-17+ |
| InChIKey | LVHDYMDLKFLREW-OCSSWDANSA-N |
| XLogP | 7.61 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.92 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|